3,4-dihydro-2H-chroMen-4-aMine hydrochloride - Names and Identifiers
Name | Chroman-4-ylamine
|
Synonyms | AKOS BB-9702 4-aminochroman Chroman-4-amine CHROMAN-4-YLAMINE Chroman-4-ylamine AKOS BBS-00006847 3,4-Dihydro-2H-chromen-4-amin 3,4-DIHYDRO-2H-CHROMEN-4-AMINE 3,4-DIHYDRO-2H-CHROMEN-4-YLAMINE 3,4-Dihydro-2H-1-benzopyran-4-amine 2H-1-BENZOPYRAN-4-AMINE, 3,4-DIHYDRO- 2H-1-benzopyran-4-amine, 3,4-dihydro- (4R)-3,4-dihydro-2H-chromen-4-aminium (4S)-3,4-dihydro-2H-chromen-4-aminium 3,4-dihydro-2H-chroMen-4-aMine hydrochloride
|
CAS | 53981-38-7
|
InChI | InChI=1/C9H11NO/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-4,8H,5-6,10H2/p+1/t8-/m0/s1 |
3,4-dihydro-2H-chroMen-4-aMine hydrochloride - Physico-chemical Properties
Molecular Formula | C9H11NO
|
Molar Mass | 149.19 |
Density | 1.106±0.06 g/cm3(Predicted) |
Boling Point | 237.4±39.0 °C(Predicted) |
Flash Point | 102.1°C |
Vapor Presure | 0.0449mmHg at 25°C |
pKa | 8.87±0.20(Predicted) |
Storage Condition | 2-8°C(protect from light) |
3,4-dihydro-2H-chroMen-4-aMine hydrochloride - Risk and Safety
Hazard Symbols | Xn - Harmful
|
Risk Codes | 22 - Harmful if swallowed
|
3,4-dihydro-2H-chroMen-4-aMine hydrochloride - Introduction
Chroman-4-ylamine, also known as Chroman-4-ylamine, is an organic compound with the chemical formula C12H13NO. It has the following properties:
1. Appearance: White to light yellow crystalline powder.
2. solubility: slightly soluble in water, soluble in organic solvents such as ethanol and chloroform.
3. Melting point: about 120-125°C.
4. Easy to oxidize: Because it contains phenolic group (-OH), it is easily oxidized by oxygen in the air.
Chroman-4-ylamine can be used for the following:
1. Drug synthesis: As a drug intermediate, it can be used to synthesize a variety of drug compounds.
2. fragrance synthesis: it can be used to synthesize compounds with fragrance, such as perfume, essence, etc.
The method of preparing Chroman-4-ylamine includes the following steps:
1. p-Hydroxybenzaldehyde is reacted with malonic anhydride to obtain a benzopyrone compound.
2. Benzopyrone reacts with carbamate to generate Chroman-4-ylamine.
In terms of safety information, Chroman-4-ylamine is a chemical and requires attention to the following:
1. avoid inhalation: when using or handling should avoid inhalation of its dust or vapor, so as not to cause respiratory irritation or damage.
2. Avoid contact with skin and eyes: It may cause irritation to skin and eyes, so wear appropriate protective gloves and glasses during operation.
3. Avoid ingestion: It is toxic and should not be ingested or enter the digestive system.
4. storage note: Chroman-4-ylamine should be stored in a dry, well-ventilated place, away from heat and fire sources.
5. waste disposal: according to local laws and regulations, the correct disposal of waste, to avoid pollution to the environment.
Before using the Chroman-4-ylamine, please read and follow its safety technical instructions, and seek professional guidance when necessary.
Last Update:2024-04-09 21:21:28